C21H40O3Si — CID 169018395
2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-tris[(2-methylpropan-2-yl)oxy]silane (PubChem CID 169018395) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-tris[(2-methylpropan-2-yl)oxy]silane.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-tris[(2-methylpropan-2-yl)oxy]silane |
|---|---|
| PubChem CID | 169018395 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-tris[(2-methylpropan-2-yl)oxy]silane |
| SMILES | CC(C)(C)O[Si](CCC1CC2C=CC1C2)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-19(2,3)22-25(23-20(4,5)6,24-21(7,8)9)13-12-18-15-16-10-11-17(18)14-16/h10-11,16-18H,12-15H2,1-9H3 |
| InChIKey | ULEGDTUCQMGLFE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|