C32H54O2Si3 — CID 158466095
bis[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methylsilane (PubChem CID 158466095) has the molecular formula C32H54O2Si3 and a molecular weight of 555.04 g/mol. Its IUPAC name is bis[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methylsilane.
| Compound Name | bis[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methylsilane |
|---|---|
| PubChem CID | 158466095 |
| Molecular Formula | C32H54O2Si3 |
| Molecular Weight | 555.04 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | bis[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methylsilane |
| SMILES | C[Si](C)(CCC1CC2C=CC1C2)O[Si](C)(C)O[Si](C)(CCC1CC2C=CC1C2)CCC1CC2C=CC1C2 |
| InChI | InChI=1S/C32H54O2Si3/c1-35(2,15-12-30-21-24-6-9-27(30)18-24)33-36(3,4)34-37(5,16-13-31-22-25-7-10-28(31)19-25)17-14-32-23-26-8-11-29(32)20-26/h6-11,24-32H,12-23H2,1-5H3 |
| InChIKey | HFTOVORJFGBWFB-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.04 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|