C39H64O3Si4 — CID 140777498
2-(2-bicyclo[2.2.1]heptanyl)ethyl-[bis[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy]-phenylsilyl]oxy-dimethylsilane (PubChem CID 140777498) has the molecular formula C39H64O3Si4 and a molecular weight of 693.28 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)ethyl-[bis[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy]-phenylsilyl]oxy-dimethylsilane.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)ethyl-[bis[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy]-phenylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140777498 |
| Molecular Formula | C39H64O3Si4 |
| Molecular Weight | 693.28 g/mol |
| Exact Mass | 692.39 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)ethyl-[bis[[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-dimethylsilyl]oxy]-phenylsilyl]oxy-dimethylsilane |
| SMILES | C[Si](C)(CCC1CC2C=CC1C2)O[Si](O[Si](C)(C)CCC1CC2C=CC1C2)(O[Si](C)(C)CCC1CC2CCC1C2)c1ccccc1 |
| InChI | InChI=1S/C39H64O3Si4/c1-43(2,21-18-36-27-30-12-15-33(36)24-30)40-46(39-10-8-7-9-11-39,41-44(3,4)22-19-37-28-31-13-16-34(37)25-31)42-45(5,6)23-20-38-29-32-14-17-35(38)26-32/h7-13,15-16,30-38H,14,17-29H2,1-6H3 |
| InChIKey | CVWUZUVEQKFFQQ-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.28 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|