C10H17AlO — CID 16687358
[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy-dimethylalumane (PubChem CID 16687358) has the molecular formula C10H17AlO and a molecular weight of 180.23 g/mol. Its IUPAC name is [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy-dimethylalumane.
| Compound Name | [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy-dimethylalumane |
|---|---|
| PubChem CID | 16687358 |
| Molecular Formula | C10H17AlO |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy-dimethylalumane |
| SMILES | C[Al](C)OCC1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C8H11O.2CH3.Al/c9-5-8-4-6-1-2-7(8)3-6;;;/h1-2,6-8H,3-5H2;2*1H3;/q-1;;;+1/t6-,7+,8?;;;/m1.../s1 |
| InChIKey | DSMYHAPNOLNKDT-FGIGCNGDSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|