C20H24O12 — CID 157305496
(2S,3R,5R)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid;(2S,3R,5S)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid (PubChem CID 157305496) has the molecular formula C20H24O12 and a molecular weight of 456.40 g/mol. Its IUPAC name is (2S,3R,5R)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid;(2S,3R,5S)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid.
| Compound Name | (2S,3R,5R)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid;(2S,3R,5S)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 157305496 |
| Molecular Formula | C20H24O12 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (2S,3R,5R)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid;(2S,3R,5S)-bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid |
| SMILES | O=C(O)[C@@H]1C2CC(C[C@H]2C(=O)O)[C@@H]1C(=O)O.O=C(O)[C@H]1CC2CC1[C@@H](C(=O)O)[C@H]2C(=O)O |
| InChI | InChI=1S/2C10H12O6/c2*11-8(12)5-2-3-1-4(5)7(10(15)16)6(3)9(13)14/h2*3-7H,1-2H2,(H,11,12)(H,13,14)(H,15,16)/t3?,4?,5-,6+,7-;3?,4?,5-,6-,7+/m10/s1 |
| InChIKey | BCKLEDQRJRANHT-ZRDHHXPYSA-N |
| XLogP | 0.26 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |