C8H10O3 — CID 163984291
(2S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylic acid (PubChem CID 163984291) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (2S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylic acid.
| Compound Name | (2S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylic acid |
|---|---|
| PubChem CID | 163984291 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (2S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylic acid |
| SMILES | O=C(O)C1CC2CC1C1O[C@@H]21 |
| InChI | InChI=1S/C8H10O3/c9-8(10)5-2-3-1-4(5)7-6(3)11-7/h3-7H,1-2H2,(H,9,10)/t3?,4?,5?,6-,7?/m0/s1 |
| InChIKey | TUYAYQSYGXMTGC-SNISAXQASA-N |
| XLogP | 0.49 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|