C12H18O3 — CID 98156367
butyl (1R,2R,4R,5S,6R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 98156367) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is butyl (1R,2R,4R,5S,6R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | butyl (1R,2R,4R,5S,6R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 98156367 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | butyl (1R,2R,4R,5S,6R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@H]2C[C@@H]1[C@H]1O[C@H]21 |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-14-12(13)9-6-7-5-8(9)11-10(7)15-11/h7-11H,2-6H2,1H3/t7-,8+,9-,10-,11-/m1/s1 |
| InChIKey | PUSQGAQLNXZHQQ-RCZSTQMZSA-N |
| XLogP | 1.75 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|