C38H62O10 — CID 101310635
4-O-[4-(4-nonoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carbonyl)oxybutyl] 3-O-nonyl 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 101310635) has the molecular formula C38H62O10 and a molecular weight of 678.90 g/mol. Its IUPAC name is 4-O-[4-(4-nonoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carbonyl)oxybutyl] 3-O-nonyl 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
| Compound Name | 4-O-[4-(4-nonoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carbonyl)oxybutyl] 3-O-nonyl 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101310635 |
| Molecular Formula | C38H62O10 |
| Molecular Weight | 678.90 g/mol |
| Exact Mass | 678.43 |
| IUPAC Name | 4-O-[4-(4-nonoxycarbonyl-7-oxabicyclo[4.1.0]heptane-3-carbonyl)oxybutyl] 3-O-nonyl 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CC2OC2CC1C(=O)OCCCCOC(=O)C1CC2OC2CC1C(=O)OCCCCCCCCC |
| InChI | InChI=1S/C38H62O10/c1-3-5-7-9-11-13-15-19-43-35(39)27-23-31-33(47-31)25-29(27)37(41)45-21-17-18-22-46-38(42)30-26-34-32(48-34)24-28(30)36(40)44-20-16-14-12-10-8-6-4-2/h27-34H,3-26H2,1-2H3 |
| InChIKey | CNGPZXBKXBAENT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|