C14H18O8 — CID 67173351
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,3,6,7-tetracarboxylic acid (PubChem CID 67173351) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,3,6,7-tetracarboxylic acid.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,3,6,7-tetracarboxylic acid |
|---|---|
| PubChem CID | 67173351 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,3,6,7-tetracarboxylic acid |
| SMILES | O=C(O)C1CC2CC(C(=O)O)C(C(=O)O)CC2CC1C(=O)O |
| InChI | InChI=1S/C14H18O8/c15-11(16)7-1-5-2-9(13(19)20)10(14(21)22)4-6(5)3-8(7)12(17)18/h5-10H,1-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | CLKNJFRAWZLDLO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |