C10H14O4 — CID 94037473
(1R,6R)-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-dicarboxylic acid (PubChem CID 94037473) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1R,6R)-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-dicarboxylic acid.
| Compound Name | (1R,6R)-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-dicarboxylic acid |
|---|---|
| PubChem CID | 94037473 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1R,6R)-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC2CC[C@@H](C(=O)O)C21 |
| InChI | InChI=1S/C10H14O4/c11-9(12)6-3-1-5-2-4-7(8(5)6)10(13)14/h5-8H,1-4H2,(H,11,12)(H,13,14)/t5?,6-,7-,8?/m1/s1 |
| InChIKey | MBBWTDIFIBFBDF-MIDKJMSJSA-N |
| XLogP | 1.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |