C8H12O6 — CID 68905410
(1R,2S,4R,5S)-4,5-dihydroxycyclohexane-1,2-dicarboxylic acid (PubChem CID 68905410) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is (1R,2S,4R,5S)-4,5-dihydroxycyclohexane-1,2-dicarboxylic acid.
| Compound Name | (1R,2S,4R,5S)-4,5-dihydroxycyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 68905410 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (1R,2S,4R,5S)-4,5-dihydroxycyclohexane-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](O)[C@@H](O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C8H12O6/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h3-6,9-10H,1-2H2,(H,11,12)(H,13,14)/t3-,4+,5+,6- |
| InChIKey | IMRVRTDYOOJNHM-GUCUJZIJSA-N |
| XLogP | -1.10 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |