(1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid

C9H12O2 — CID 131034566

IUPAC(1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid
SMILESO=C(O)C1[C@H]2C[C@H]3C[C@@H]1[C@@H]3C2
InChIInChI=1S/C9H12O2/c10-9(11)8-5-1-4-2-7(8)6(4)3-5/h4-8H,1-3H2,(H,10,11)/t4-,5-,6+,7+,8?/m0/s1
InChIKeyCLBJSSKLHAVTRP-QKVVPUOZSA-N
MW152.19 g/mol
LogP1.36
Rot. Bonds1

About (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid

(1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid (PubChem CID 131034566) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid.

Molecular Properties

Compound Name(1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid
PubChem CID131034566
Molecular FormulaC9H12O2
Molecular Weight152.19 g/mol
Exact Mass152.08
IUPAC Name(1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid
SMILESO=C(O)C1[C@H]2C[C@H]3C[C@@H]1[C@@H]3C2
InChIInChI=1S/C9H12O2/c10-9(11)8-5-1-4-2-7(8)6(4)3-5/h4-8H,1-3H2,(H,10,11)/t4-,5-,6+,7+,8?/m0/s1
InChIKeyCLBJSSKLHAVTRP-QKVVPUOZSA-N
XLogP1.36
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.19
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid?
The IUPAC name of (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid (CID 131034566) is (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid.
What is the SMILES notation for (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid?
The canonical SMILES for (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid is O=C(O)C1[C@H]2C[C@H]3C[C@@H]1[C@@H]3C2.
What is the InChIKey of (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid?
The InChIKey is CLBJSSKLHAVTRP-QKVVPUOZSA-N. The full InChI is InChI=1S/C9H12O2/c10-9(11)8-5-1-4-2-7(8)6(4)3-5/h4-8H,1-3H2,(H,10,11)/t4-,5-,6+,7+,8?/m0/s1.
What are the key properties of (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid?
(1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid has a molecular weight of 152.19 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R,5S,6R)-tricyclo[3.2.1.03,6]octane-2-carboxylic acid is sourced from PubChem (CID 131034566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).