C11H16O3 — CID 100872241
(1S,2R,3S,4S,5S,7S)-4-hydroxyadamantane-2-carboxylic acid (PubChem CID 100872241) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1S,2R,3S,4S,5S,7S)-4-hydroxyadamantane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4S,5S,7S)-4-hydroxyadamantane-2-carboxylic acid |
|---|---|
| PubChem CID | 100872241 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1S,2R,3S,4S,5S,7S)-4-hydroxyadamantane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C[C@H]3C[C@@H](C2)[C@H](O)[C@H]1C3 |
| InChI | InChI=1S/C11H16O3/c12-10-7-2-5-1-6(4-7)9(11(13)14)8(10)3-5/h5-10,12H,1-4H2,(H,13,14)/t5-,6-,7-,8-,9+,10-/m0/s1 |
| InChIKey | BTKTYXAETPGDIU-UCKHGQTESA-N |
| XLogP | 1.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |