About 4-methyladamantan-2-ol
4-methyladamantan-2-ol (PubChem CID 590471) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-methyladamantan-2-ol.
Molecular Properties
| Compound Name | 4-methyladamantan-2-ol |
| PubChem CID | 590471 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-methyladamantan-2-ol |
| SMILES | CC1C2CC3CC(C2)C(O)C1C3 |
| InChI | InChI=1S/C11H18O/c1-6-8-2-7-3-9(5-8)11(12)10(6)4-7/h6-12H,2-5H2,1H3 |
| InChIKey | RIVBKQYYKFPXEX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyladamantan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyladamantan-2-ol?
The IUPAC name of 4-methyladamantan-2-ol (CID 590471) is 4-methyladamantan-2-ol.
What is the SMILES notation for 4-methyladamantan-2-ol?
The canonical SMILES for 4-methyladamantan-2-ol is CC1C2CC3CC(C2)C(O)C1C3.
What is the InChIKey of 4-methyladamantan-2-ol?
The InChIKey is RIVBKQYYKFPXEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-6-8-2-7-3-9(5-8)11(12)10(6)4-7/h6-12H,2-5H2,1H3.
What are the key properties of 4-methyladamantan-2-ol?
4-methyladamantan-2-ol has a molecular weight of 166.26 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyladamantan-2-ol is sourced from PubChem (CID 590471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).