About ethane;2-methyladamantane
ethane;2-methyladamantane (PubChem CID 90765849) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is ethane;2-methyladamantane.
Molecular Properties
| Compound Name | ethane;2-methyladamantane |
| PubChem CID | 90765849 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | ethane;2-methyladamantane |
| SMILES | CC.CC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H18.C2H6/c1-7-10-3-8-2-9(5-10)6-11(7)4-8;1-2/h7-11H,2-6H2,1H3;1-2H3 |
| InChIKey | MRBPXFQGXJJCOT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyladamantane?
The IUPAC name of ethane;2-methyladamantane (CID 90765849) is ethane;2-methyladamantane.
What is the SMILES notation for ethane;2-methyladamantane?
The canonical SMILES for ethane;2-methyladamantane is CC.CC1C2CC3CC(C2)CC1C3.
What is the InChIKey of ethane;2-methyladamantane?
The InChIKey is MRBPXFQGXJJCOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18.C2H6/c1-7-10-3-8-2-9(5-10)6-11(7)4-8;1-2/h7-11H,2-6H2,1H3;1-2H3.
What are the key properties of ethane;2-methyladamantane?
ethane;2-methyladamantane has a molecular weight of 180.33 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyladamantane is sourced from PubChem (CID 90765849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).