About adamantane;ethane;methane
adamantane;ethane;methane (PubChem CID 157076952) has the molecular formula C16H36
and a molecular weight of 228.46 g/mol. Its IUPAC name is adamantane;ethane;methane.
Molecular Properties
| Compound Name | adamantane;ethane;methane |
| PubChem CID | 157076952 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | adamantane;ethane;methane |
| SMILES | C.C.C1C2CC3CC1CC(C2)C3.CC.CC |
| InChI | InChI=1S/C10H16.2C2H6.2CH4/c1-7-2-9-4-8(1)5-10(3-7)6-9;2*1-2;;/h7-10H,1-6H2;2*1-2H3;2*1H4 |
| InChIKey | ADBSPIMIMVHZHA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;ethane;methane?
The IUPAC name of adamantane;ethane;methane (CID 157076952) is adamantane;ethane;methane.
What is the SMILES notation for adamantane;ethane;methane?
The canonical SMILES for adamantane;ethane;methane is C.C.C1C2CC3CC1CC(C2)C3.CC.CC.
What is the InChIKey of adamantane;ethane;methane?
The InChIKey is ADBSPIMIMVHZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.2C2H6.2CH4/c1-7-2-9-4-8(1)5-10(3-7)6-9;2*1-2;;/h7-10H,1-6H2;2*1-2H3;2*1H4.
What are the key properties of adamantane;ethane;methane?
adamantane;ethane;methane has a molecular weight of 228.46 g/mol, XLogP of 6.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;ethane;methane is sourced from PubChem (CID 157076952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).