About ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane
ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 91434011) has the molecular formula C20H38
and a molecular weight of 278.52 g/mol. Its IUPAC name is ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
Analyze ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The IUPAC name of ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (CID 91434011) is ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
What is the SMILES notation for ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The canonical SMILES for ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is C1C2CC3C4CC5CC(C14)C(C2)C3C5.CC.CC.CC.
What is the InChIKey of ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The InChIKey is YKIGJNNZMRDFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20.3C2H6/c1-7-2-12-10-4-8-5-11(9(1)10)13(3-7)14(12)6-8;3*1-2/h7-14H,1-6H2;3*1-2H3.
What are the key properties of ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane has a molecular weight of 278.52 g/mol, XLogP of 6.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is sourced from PubChem (CID 91434011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).