C16H24 — CID 59157224
4-ethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 59157224) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 4-ethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | 4-ethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 59157224 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 4-ethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | CCC12CC3C4CC5CC3C(C1)C(C5)C4C2 |
| InChI | InChI=1S/C16H24/c1-2-16-6-13-10-3-9-4-11(13)15(8-16)12(5-9)14(10)7-16/h9-15H,2-8H2,1H3 |
| InChIKey | LYXWUOWAPQYCAD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |