C12H20 — CID 173088739
6-ethyltricyclo[4.3.1.03,8]decane (PubChem CID 173088739) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 6-ethyltricyclo[4.3.1.03,8]decane.
| Compound Name | 6-ethyltricyclo[4.3.1.03,8]decane |
|---|---|
| PubChem CID | 173088739 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 6-ethyltricyclo[4.3.1.03,8]decane |
| SMILES | CCC12CCC3CC(CC3C1)C2 |
| InChI | InChI=1S/C12H20/c1-2-12-4-3-10-5-9(7-12)6-11(10)8-12/h9-11H,2-8H2,1H3 |
| InChIKey | WGFSKUBWGCOLKR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |