About 6-ethyltricyclo[4.3.1.03,8]decane
6-ethyltricyclo[4.3.1.03,8]decane (PubChem CID 173088739) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 6-ethyltricyclo[4.3.1.03,8]decane.
Molecular Properties
| Compound Name | 6-ethyltricyclo[4.3.1.03,8]decane |
| PubChem CID | 173088739 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 6-ethyltricyclo[4.3.1.03,8]decane |
| SMILES | CCC12CCC3CC(CC3C1)C2 |
| InChI | InChI=1S/C12H20/c1-2-12-4-3-10-5-9(7-12)6-11(10)8-12/h9-11H,2-8H2,1H3 |
| InChIKey | WGFSKUBWGCOLKR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-ethyltricyclo[4.3.1.03,8]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyltricyclo[4.3.1.03,8]decane?
The IUPAC name of 6-ethyltricyclo[4.3.1.03,8]decane (CID 173088739) is 6-ethyltricyclo[4.3.1.03,8]decane.
What is the SMILES notation for 6-ethyltricyclo[4.3.1.03,8]decane?
The canonical SMILES for 6-ethyltricyclo[4.3.1.03,8]decane is CCC12CCC3CC(CC3C1)C2.
What is the InChIKey of 6-ethyltricyclo[4.3.1.03,8]decane?
The InChIKey is WGFSKUBWGCOLKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-2-12-4-3-10-5-9(7-12)6-11(10)8-12/h9-11H,2-8H2,1H3.
What are the key properties of 6-ethyltricyclo[4.3.1.03,8]decane?
6-ethyltricyclo[4.3.1.03,8]decane has a molecular weight of 164.29 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyltricyclo[4.3.1.03,8]decane is sourced from PubChem (CID 173088739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).