C34H52 — CID 58695293
1,3-bis(3-ethyl-1-adamantyl)adamantane (PubChem CID 58695293) has the molecular formula C34H52 and a molecular weight of 460.79 g/mol. Its IUPAC name is 1,3-bis(3-ethyl-1-adamantyl)adamantane.
| Compound Name | 1,3-bis(3-ethyl-1-adamantyl)adamantane |
|---|---|
| PubChem CID | 58695293 |
| Molecular Formula | C34H52 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.41 |
| IUPAC Name | 1,3-bis(3-ethyl-1-adamantyl)adamantane |
| SMILES | CCC12CC3CC(C1)CC(C14CC5CC(C1)CC(C16CC7CC(CC(CC)(C7)C1)C6)(C5)C4)(C3)C2 |
| InChI | InChI=1S/C34H52/c1-3-29-8-23-5-24(9-29)13-31(12-23,20-29)33-16-27-7-28(17-33)19-34(18-27,22-33)32-14-25-6-26(15-32)11-30(4-2,10-25)21-32/h23-28H,3-22H2,1-2H3 |
| InChIKey | PRUAHZMBWFUJTB-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |