C15H25NO2 — CID 2842965
ethyl N-(3-ethyl-1-adamantyl)carbamate (PubChem CID 2842965) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is ethyl N-(3-ethyl-1-adamantyl)carbamate.
| Compound Name | ethyl N-(3-ethyl-1-adamantyl)carbamate |
|---|---|
| PubChem CID | 2842965 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethyl N-(3-ethyl-1-adamantyl)carbamate |
| SMILES | CCOC(=O)NC12CC3CC(CC(CC)(C3)C1)C2 |
| InChI | InChI=1S/C15H25NO2/c1-3-14-6-11-5-12(7-14)9-15(8-11,10-14)16-13(17)18-4-2/h11-12H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | KQFAELSJXQQXTK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |