C15H25NO3 — CID 59134555
tert-butyl N-(3-hydroxy-1-adamantyl)carbamate (PubChem CID 59134555) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl N-(3-hydroxy-1-adamantyl)carbamate.
| Compound Name | tert-butyl N-(3-hydroxy-1-adamantyl)carbamate |
|---|---|
| PubChem CID | 59134555 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | tert-butyl N-(3-hydroxy-1-adamantyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C15H25NO3/c1-13(2,3)19-12(17)16-14-5-10-4-11(6-14)8-15(18,7-10)9-14/h10-11,18H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | AFKHMILYNDSAGD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |