C23H34N4O3 — CID 166423356
tert-butyl N-[3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-adamantyl]carbamate (PubChem CID 166423356) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-adamantyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-adamantyl]carbamate |
|---|---|
| PubChem CID | 166423356 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | tert-butyl N-[3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-adamantyl]carbamate |
| SMILES | C#CCCC1(CCC(=O)NC23CC4CC(C2)CC(NC(=O)OC(C)(C)C)(C4)C3)N=N1 |
| InChI | InChI=1S/C23H34N4O3/c1-5-6-8-23(26-27-23)9-7-18(28)24-21-11-16-10-17(12-21)14-22(13-16,15-21)25-19(29)30-20(2,3)4/h1,16-17H,6-15H2,2-4H3,(H,24,28)(H,25,29) |
| InChIKey | LFKLJMGDPFYUSN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|