C22H34N4O3 — CID 166423374
tert-butyl 8-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 166423374) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl 8-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | tert-butyl 8-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 166423374 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl 8-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | C#CCCC1(CCC(=O)NC2CCC3(CCCN3C(=O)OC(C)(C)C)CC2)N=N1 |
| InChI | InChI=1S/C22H34N4O3/c1-5-6-12-22(24-25-22)15-10-18(27)23-17-8-13-21(14-9-17)11-7-16-26(21)19(28)29-20(2,3)4/h1,17H,6-16H2,2-4H3,(H,23,27) |
| InChIKey | SGSMXCGUMWVFBK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|