C29H41N5O5 — CID 72702478
benzyl (2S)-4-azido-2-[3-[(5S,7R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]propanoylamino]butanoate (PubChem CID 72702478) has the molecular formula C29H41N5O5 and a molecular weight of 539.68 g/mol. Its IUPAC name is benzyl (2S)-4-azido-2-[3-[(5S,7R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]propanoylamino]butanoate.
| Compound Name | benzyl (2S)-4-azido-2-[3-[(5S,7R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]propanoylamino]butanoate |
|---|---|
| PubChem CID | 72702478 |
| Molecular Formula | C29H41N5O5 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | benzyl (2S)-4-azido-2-[3-[(5S,7R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]propanoylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)NC12C[C@@H]3C[C@@H](CC(CCC(=O)N[C@@H](CCN=[N+]=[N-])C(=O)OCc4ccccc4)(C3)C1)C2 |
| InChI | InChI=1S/C29H41N5O5/c1-27(2,3)39-26(37)33-29-16-21-13-22(17-29)15-28(14-21,19-29)11-9-24(35)32-23(10-12-31-34-30)25(36)38-18-20-7-5-4-6-8-20/h4-8,21-23H,9-19H2,1-3H3,(H,32,35)(H,33,37)/t21-,22+,23-,28?,29?/m0/s1 |
| InChIKey | AZKRFOYAVCLJDO-NMIMRPOSSA-N |
| XLogP | 5.56 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|