C45H53N5O9 — CID 102233701
benzyl (2S)-4-[[(2R,3R,4R,5S,6R)-6-(2-azidoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 102233701) has the molecular formula C45H53N5O9 and a molecular weight of 807.95 g/mol. Its IUPAC name is benzyl (2S)-4-[[(2R,3R,4R,5S,6R)-6-(2-azidoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | benzyl (2S)-4-[[(2R,3R,4R,5S,6R)-6-(2-azidoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 102233701 |
| Molecular Formula | C45H53N5O9 |
| Molecular Weight | 807.95 g/mol |
| Exact Mass | 807.38 |
| IUPAC Name | benzyl (2S)-4-[[(2R,3R,4R,5S,6R)-6-(2-azidoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)NC[C@H]1O[C@H](CCN=[N+]=[N-])[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C45H53N5O9/c1-45(2,3)59-44(53)49-36(43(52)57-31-35-22-14-7-15-23-35)26-39(51)47-27-38-41(55-29-33-18-10-5-11-19-33)42(56-30-34-20-12-6-13-21-34)40(37(58-38)24-25-48-50-46)54-28-32-16-8-4-9-17-32/h4-23,36-38,40-42H,24-31H2,1-3H3,(H,47,51)(H,49,53)/t36-,37+,38+,40-,41+,42+/m0/s1 |
| InChIKey | NBWVLYRFENKAES-RKGQQFJVSA-N |
| XLogP | 7.35 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.95 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|