C39H51NO9 — CID 102009425
methyl (2S)-6-[(2R,3S,4R,5S,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 102009425) has the molecular formula C39H51NO9 and a molecular weight of 677.84 g/mol. Its IUPAC name is methyl (2S)-6-[(2R,3S,4R,5S,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-6-[(2R,3S,4R,5S,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 102009425 |
| Molecular Formula | C39H51NO9 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.36 |
| IUPAC Name | methyl (2S)-6-[(2R,3S,4R,5S,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCC[C@H]1O[C@H](CO)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H51NO9/c1-39(2,3)49-38(43)40-31(37(42)44-4)22-14-15-23-32-34(45-25-28-16-8-5-9-17-28)36(47-27-30-20-12-7-13-21-30)35(33(24-41)48-32)46-26-29-18-10-6-11-19-29/h5-13,16-21,31-36,41H,14-15,22-27H2,1-4H3,(H,40,43)/t31-,32+,33+,34-,35-,36+/m0/s1 |
| InChIKey | LXCASSSYCWSVBS-OFLUCUDDSA-N |
| XLogP | 6.13 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|