C37H46N4O8 — CID 71762165
methyl (2S)-4-[(2S,3S,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 71762165) has the molecular formula C37H46N4O8 and a molecular weight of 674.80 g/mol. Its IUPAC name is methyl (2S)-4-[(2S,3S,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl (2S)-4-[(2S,3S,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 71762165 |
| Molecular Formula | C37H46N4O8 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | methyl (2S)-4-[(2S,3S,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)[C@H](CC[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H46N4O8/c1-37(2,3)49-36(43)39-29(35(42)44-4)20-21-30-32(40-41-38)34(47-24-28-18-12-7-13-19-28)33(46-23-27-16-10-6-11-17-27)31(48-30)25-45-22-26-14-8-5-9-15-26/h5-19,29-34H,20-25H2,1-4H3,(H,39,43)/t29-,30-,31+,32-,33+,34+/m0/s1 |
| InChIKey | OHWHCCHBPBBMAQ-BAKHARCTSA-N |
| XLogP | 6.67 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|