C41H52N2O9 — CID 101204137
methyl (E,2S)-6-[(2R,3S,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-enoate (PubChem CID 101204137) has the molecular formula C41H52N2O9 and a molecular weight of 716.87 g/mol. Its IUPAC name is methyl (E,2S)-6-[(2R,3S,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-enoate.
| Compound Name | methyl (E,2S)-6-[(2R,3S,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-enoate |
|---|---|
| PubChem CID | 101204137 |
| Molecular Formula | C41H52N2O9 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.37 |
| IUPAC Name | methyl (E,2S)-6-[(2R,3S,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-enoate |
| SMILES | COC(=O)[C@H](C/C=C/C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H52N2O9/c1-29(44)42-36-34(24-16-15-23-33(39(45)47-5)43-40(46)52-41(2,3)4)51-35(28-48-25-30-17-9-6-10-18-30)37(49-26-31-19-11-7-12-20-31)38(36)50-27-32-21-13-8-14-22-32/h6-22,33-38H,23-28H2,1-5H3,(H,42,44)(H,43,46)/b16-15+/t33-,34+,35+,36-,37+,38+/m0/s1 |
| InChIKey | ZYFBVMLISULDHT-YPMPDRDGSA-N |
| XLogP | 6.05 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|