C47H57NO10 — CID 101010087
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(E)-4-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]but-2-enoxy]propanoate (PubChem CID 101010087) has the molecular formula C47H57NO10 and a molecular weight of 795.97 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(E)-4-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]but-2-enoxy]propanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(E)-4-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]but-2-enoxy]propanoate |
|---|---|
| PubChem CID | 101010087 |
| Molecular Formula | C47H57NO10 |
| Molecular Weight | 795.97 g/mol |
| Exact Mass | 795.40 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(E)-4-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]but-2-enoxy]propanoate |
| SMILES | COC(=O)[C@H](COC/C=C/C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C47H57NO10/c1-47(2,3)58-46(50)48-39(45(49)51-4)33-52-28-18-17-27-40-42(54-30-36-21-11-6-12-22-36)44(56-32-38-25-15-8-16-26-38)43(55-31-37-23-13-7-14-24-37)41(57-40)34-53-29-35-19-9-5-10-20-35/h5-26,39-44H,27-34H2,1-4H3,(H,48,50)/b18-17+/t39-,40+,41+,42-,43+,44+/m0/s1 |
| InChIKey | CKLCNSAROLJDHR-NFGOAXTISA-N |
| XLogP | 7.76 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.97 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|