C33H39NO7 — CID 10929773
tert-butyl N-[(1R)-1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxoethyl]carbamate (PubChem CID 10929773) has the molecular formula C33H39NO7 and a molecular weight of 561.68 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 10929773 |
| Molecular Formula | C33H39NO7 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | tert-butyl N-[(1R)-1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C=O)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H39NO7/c1-33(2,3)41-32(36)34-27(19-35)29-31(39-22-26-17-11-6-12-18-26)30(38-21-25-15-9-5-10-16-25)28(40-29)23-37-20-24-13-7-4-8-14-24/h4-19,27-31H,20-23H2,1-3H3,(H,34,36)/t27-,28+,29+,30+,31+/m0/s1 |
| InChIKey | DRUUXVAWJQRNBQ-SIMGMAISSA-N |
| XLogP | 5.23 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|