C49H57NO9S — CID 102245675
tert-butyl N-[1-(4-methylphenyl)sulfonyl-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]carbamate (PubChem CID 102245675) has the molecular formula C49H57NO9S and a molecular weight of 836.06 g/mol. Its IUPAC name is tert-butyl N-[1-(4-methylphenyl)sulfonyl-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-methylphenyl)sulfonyl-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 102245675 |
| Molecular Formula | C49H57NO9S |
| Molecular Weight | 836.06 g/mol |
| Exact Mass | 835.38 |
| IUPAC Name | tert-butyl N-[1-(4-methylphenyl)sulfonyl-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)C(CC[C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C49H57NO9S/c1-36-25-27-41(28-26-36)60(52,53)44(50-48(51)59-49(2,3)4)30-29-42-45(55-32-38-19-11-6-12-20-38)47(57-34-40-23-15-8-16-24-40)46(56-33-39-21-13-7-14-22-39)43(58-42)35-54-31-37-17-9-5-10-18-37/h5-28,42-47H,29-35H2,1-4H3,(H,50,51)/t42-,43-,44?,45+,46+,47-/m1/s1 |
| InChIKey | HUTAMYQDTQSDKY-JFYHERKZSA-N |
| XLogP | 9.14 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.06 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |