C48H53NO9 — CID 102245685
methyl 3-(phenylmethoxycarbonylamino)-5-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate (PubChem CID 102245685) has the molecular formula C48H53NO9 and a molecular weight of 787.95 g/mol. Its IUPAC name is methyl 3-(phenylmethoxycarbonylamino)-5-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate.
| Compound Name | methyl 3-(phenylmethoxycarbonylamino)-5-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate |
|---|---|
| PubChem CID | 102245685 |
| Molecular Formula | C48H53NO9 |
| Molecular Weight | 787.95 g/mol |
| Exact Mass | 787.37 |
| IUPAC Name | methyl 3-(phenylmethoxycarbonylamino)-5-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate |
| SMILES | COC(=O)CC(CC[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C48H53NO9/c1-52-44(50)29-41(49-48(51)57-34-40-25-15-6-16-26-40)27-28-42-45(54-31-37-19-9-3-10-20-37)47(56-33-39-23-13-5-14-24-39)46(55-32-38-21-11-4-12-22-38)43(58-42)35-53-30-36-17-7-2-8-18-36/h2-26,41-43,45-47H,27-35H2,1H3,(H,49,51)/t41?,42-,43-,45-,46-,47-/m1/s1 |
| InChIKey | VLCZCXVVNLTALA-VIGSFGBDSA-N |
| XLogP | 8.37 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.95 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |