C41H48O9 — CID 73056054
ethyl (2S,3R)-2,3-dihydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate (PubChem CID 73056054) has the molecular formula C41H48O9 and a molecular weight of 684.83 g/mol. Its IUPAC name is ethyl (2S,3R)-2,3-dihydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate.
| Compound Name | ethyl (2S,3R)-2,3-dihydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate |
|---|---|
| PubChem CID | 73056054 |
| Molecular Formula | C41H48O9 |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | ethyl (2S,3R)-2,3-dihydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pentanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)CC[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H48O9/c1-2-46-41(44)37(43)34(42)23-24-35-38(47-26-31-17-9-4-10-18-31)40(49-28-33-21-13-6-14-22-33)39(48-27-32-19-11-5-12-20-32)36(50-35)29-45-25-30-15-7-3-8-16-30/h3-22,34-40,42-43H,2,23-29H2,1H3/t34-,35+,36-,37+,38+,39+,40-/m1/s1 |
| InChIKey | UAADTLIMCVSITN-KUGPWIRXSA-N |
| XLogP | 5.79 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |