C44H46O7Se — CID 139265325
ethyl (2S)-2-phenylselanyl-2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate (PubChem CID 139265325) has the molecular formula C44H46O7Se and a molecular weight of 765.81 g/mol. Its IUPAC name is ethyl (2S)-2-phenylselanyl-2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate.
| Compound Name | ethyl (2S)-2-phenylselanyl-2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 139265325 |
| Molecular Formula | C44H46O7Se |
| Molecular Weight | 765.81 g/mol |
| Exact Mass | 766.24 |
| IUPAC Name | ethyl (2S)-2-phenylselanyl-2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
| SMILES | CCOC(=O)[C@@H]([Se]c1ccccc1)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H46O7Se/c1-2-47-44(45)43(52-37-26-16-7-17-27-37)42-41(50-31-36-24-14-6-15-25-36)40(49-30-35-22-12-5-13-23-35)39(48-29-34-20-10-4-11-21-34)38(51-42)32-46-28-33-18-8-3-9-19-33/h3-27,38-43H,2,28-32H2,1H3/t38-,39-,40+,41+,42-,43+/m1/s1 |
| InChIKey | NZUKLCQGJSPCES-IZKUIEKQSA-N |
| XLogP | 7.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.81 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|