C42H48O9 — CID 11072526
ethyl [(Z,2R,5R)-5-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-3-en-2-yl] carbonate (PubChem CID 11072526) has the molecular formula C42H48O9 and a molecular weight of 696.84 g/mol. Its IUPAC name is ethyl [(Z,2R,5R)-5-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-3-en-2-yl] carbonate.
| Compound Name | ethyl [(Z,2R,5R)-5-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-3-en-2-yl] carbonate |
|---|---|
| PubChem CID | 11072526 |
| Molecular Formula | C42H48O9 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | ethyl [(Z,2R,5R)-5-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-3-en-2-yl] carbonate |
| SMILES | CCOC(=O)O[C@H](C)/C=C\[C@@H](O)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H48O9/c1-3-46-42(44)50-31(2)24-25-36(43)38-40(48-28-34-20-12-6-13-21-34)41(49-29-35-22-14-7-15-23-35)39(47-27-33-18-10-5-11-19-33)37(51-38)30-45-26-32-16-8-4-9-17-32/h4-25,31,36-41,43H,3,26-30H2,1-2H3/b25-24-/t31-,36-,37-,38+,39-,40+,41+/m1/s1 |
| InChIKey | ZFSSULGGBZFSSY-RILHSUBKSA-N |
| XLogP | 7.21 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|