C32H38O8 — CID 134838937
[(3R,6R)-6-(2,3-dihydroxypropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 134838937) has the molecular formula C32H38O8 and a molecular weight of 550.65 g/mol. Its IUPAC name is [(3R,6R)-6-(2,3-dihydroxypropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-6-(2,3-dihydroxypropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134838937 |
| Molecular Formula | C32H38O8 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | [(3R,6R)-6-(2,3-dihydroxypropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](CC(O)CO)C(OCc2ccccc2)C(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H38O8/c1-23(34)36-22-29-31(38-20-25-13-7-3-8-14-25)32(39-21-26-15-9-4-10-16-26)30(28(40-29)17-27(35)18-33)37-19-24-11-5-2-6-12-24/h2-16,27-33,35H,17-22H2,1H3/t27?,28-,29?,30?,31-,32?/m1/s1 |
| InChIKey | UYCHONIRTWJDDP-BQWUGKLYSA-N |
| XLogP | 3.82 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |