C41H42O6 — CID 10908343
(S)-phenyl-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol (PubChem CID 10908343) has the molecular formula C41H42O6 and a molecular weight of 630.78 g/mol. Its IUPAC name is (S)-phenyl-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol.
| Compound Name | (S)-phenyl-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 10908343 |
| Molecular Formula | C41H42O6 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | (S)-phenyl-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol |
| SMILES | O[C@@H](c1ccccc1)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H42O6/c42-37(35-24-14-5-15-25-35)39-41(46-29-34-22-12-4-13-23-34)40(45-28-33-20-10-3-11-21-33)38(44-27-32-18-8-2-9-19-32)36(47-39)30-43-26-31-16-6-1-7-17-31/h1-25,36-42H,26-30H2/t36-,37+,38-,39+,40+,41+/m1/s1 |
| InChIKey | HKIBHXQDUIYERE-MVHHKFNYSA-N |
| XLogP | 7.46 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |