C41H41N3O5 — CID 16749076
(2S,3S,4R,5R,6R)-2-[(S)-azido(phenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 16749076) has the molecular formula C41H41N3O5 and a molecular weight of 655.80 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[(S)-azido(phenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4R,5R,6R)-2-[(S)-azido(phenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 16749076 |
| Molecular Formula | C41H41N3O5 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[(S)-azido(phenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | [N-]=[N+]=N[C@@H](c1ccccc1)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H41N3O5/c42-44-43-37(35-24-14-5-15-25-35)39-41(48-29-34-22-12-4-13-23-34)40(47-28-33-20-10-3-11-21-33)38(46-27-32-18-8-2-9-19-32)36(49-39)30-45-26-31-16-6-1-7-17-31/h1-25,36-41H,26-30H2/t36-,37+,38-,39+,40+,41+/m1/s1 |
| InChIKey | MZVHFJFMOYFYLL-MVHHKFNYSA-N |
| XLogP | 8.78 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|