C39H43N3O7 — CID 11125216
methyl (2S)-2-azido-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate (PubChem CID 11125216) has the molecular formula C39H43N3O7 and a molecular weight of 665.79 g/mol. Its IUPAC name is methyl (2S)-2-azido-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate.
| Compound Name | methyl (2S)-2-azido-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 11125216 |
| Molecular Formula | C39H43N3O7 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.31 |
| IUPAC Name | methyl (2S)-2-azido-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
| SMILES | COC(=O)[C@H](CC[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C39H43N3O7/c1-44-39(43)33(41-42-40)22-23-34-36(46-25-30-16-8-3-9-17-30)38(48-27-32-20-12-5-13-21-32)37(47-26-31-18-10-4-11-19-31)35(49-34)28-45-24-29-14-6-2-7-15-29/h2-21,33-38H,22-28H2,1H3/t33-,34-,35+,36-,37+,38+/m0/s1 |
| InChIKey | QBSRPTQVVRZAPS-PMRZUYJQSA-N |
| XLogP | 7.36 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|