C45H44N4O7 — CID 100991204
(2S)-2-azido-3-[2-[(2S,3S,4S,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoic acid (PubChem CID 100991204) has the molecular formula C45H44N4O7 and a molecular weight of 752.87 g/mol. Its IUPAC name is (2S)-2-azido-3-[2-[(2S,3S,4S,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-azido-3-[2-[(2S,3S,4S,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 100991204 |
| Molecular Formula | C45H44N4O7 |
| Molecular Weight | 752.87 g/mol |
| Exact Mass | 752.32 |
| IUPAC Name | (2S)-2-azido-3-[2-[(2S,3S,4S,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoic acid |
| SMILES | [N-]=[N+]=N[C@@H](Cc1c([C@@H]2O[C@@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C45H44N4O7/c46-49-48-38(45(50)51)25-36-35-23-13-14-24-37(35)47-40(36)42-44(55-29-34-21-11-4-12-22-34)43(54-28-33-19-9-3-10-20-33)41(53-27-32-17-7-2-8-18-32)39(56-42)30-52-26-31-15-5-1-6-16-31/h1-24,38-39,41-44,47H,25-30H2,(H,50,51)/t38-,39-,41-,42-,43+,44-/m0/s1 |
| InChIKey | JWLMLFQIXLXMGB-KQJCSQOZSA-N |
| XLogP | 8.89 |
| TPSA | 148.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.87 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|