C42H41NO5 — CID 11296656
2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indole (PubChem CID 11296656) has the molecular formula C42H41NO5 and a molecular weight of 639.79 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indole.
| Compound Name | 2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 11296656 |
| Molecular Formula | C42H41NO5 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | 2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indole |
| SMILES | c1ccc(COC[C@H]2O[C@H](c3cc4ccccc4[nH]3)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H41NO5/c1-5-15-31(16-6-1)26-44-30-38-40(45-27-32-17-7-2-8-18-32)42(47-29-34-21-11-4-12-22-34)41(46-28-33-19-9-3-10-20-33)39(48-38)37-25-35-23-13-14-24-36(35)43-37/h1-25,38-43H,26-30H2/t38-,39-,40-,41-,42+/m1/s1 |
| InChIKey | KOWYLKDOLHMQFL-MHBOMZLCSA-N |
| XLogP | 8.58 |
| TPSA | 61.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |