C43H43NO5 — CID 15726287
1-methyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole (PubChem CID 15726287) has the molecular formula C43H43NO5 and a molecular weight of 653.82 g/mol. Its IUPAC name is 1-methyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole.
| Compound Name | 1-methyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole |
|---|---|
| PubChem CID | 15726287 |
| Molecular Formula | C43H43NO5 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | 1-methyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole |
| SMILES | Cn1c([C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C43H43NO5/c1-44-37-25-15-14-24-36(37)26-38(44)40-42(47-29-34-20-10-4-11-21-34)43(48-30-35-22-12-5-13-23-35)41(46-28-33-18-8-3-9-19-33)39(49-40)31-45-27-32-16-6-2-7-17-32/h2-26,39-43H,27-31H2,1H3/t39-,40-,41-,42+,43+/m1/s1 |
| InChIKey | JIMPYFSMUDWGNG-BALJOQLGSA-N |
| XLogP | 8.59 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |