C49H47NO7S — CID 11400131
1-(4-methylphenyl)sulfonyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole (PubChem CID 11400131) has the molecular formula C49H47NO7S and a molecular weight of 793.98 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole |
|---|---|
| PubChem CID | 11400131 |
| Molecular Formula | C49H47NO7S |
| Molecular Weight | 793.98 g/mol |
| Exact Mass | 793.31 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole |
| SMILES | Cc1ccc(S(=O)(=O)n2c([C@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)cc3ccccc32)cc1 |
| InChI | InChI=1S/C49H47NO7S/c1-36-26-28-42(29-27-36)58(51,52)50-43-25-15-14-24-41(43)30-44(50)46-48(55-33-39-20-10-4-11-21-39)49(56-34-40-22-12-5-13-23-40)47(54-32-38-18-8-3-9-19-38)45(57-46)35-53-31-37-16-6-2-7-17-37/h2-30,45-49H,31-35H2,1H3/t45-,46-,47-,48+,49+/m1/s1 |
| InChIKey | BDSUQNFNDWAIKS-IFDRYBKASA-N |
| XLogP | 9.60 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.98 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |