C53H52NO8PS — CID 14680192
N-[diphenyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-lambda5-phosphanylidene]-4-methylbenzenesulfonamide (PubChem CID 14680192) has the molecular formula C53H52NO8PS and a molecular weight of 894.04 g/mol. Its IUPAC name is N-[diphenyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-lambda5-phosphanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[diphenyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-lambda5-phosphanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 14680192 |
| Molecular Formula | C53H52NO8PS |
| Molecular Weight | 894.04 g/mol |
| Exact Mass | 893.32 |
| IUPAC Name | N-[diphenyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-lambda5-phosphanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=P(O[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C53H52NO8PS/c1-41-32-34-48(35-33-41)64(55,56)54-63(46-28-16-6-17-29-46,47-30-18-7-19-31-47)62-53-52(60-39-45-26-14-5-15-27-45)51(59-38-44-24-12-4-13-25-44)50(58-37-43-22-10-3-11-23-43)49(61-53)40-57-36-42-20-8-2-9-21-42/h2-35,49-53H,36-40H2,1H3/t49-,50-,51+,52-,53-/m1/s1 |
| InChIKey | FKDMLBKQGDJRMP-GIPKGRTISA-N |
| XLogP | 10.17 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.04 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|