C44H44N2O9S — CID 11491214
[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] N-(cyanomethyl)-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 11491214) has the molecular formula C44H44N2O9S and a molecular weight of 776.91 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] N-(cyanomethyl)-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] N-(cyanomethyl)-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 11491214 |
| Molecular Formula | C44H44N2O9S |
| Molecular Weight | 776.91 g/mol |
| Exact Mass | 776.28 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] N-(cyanomethyl)-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC#N)C(=O)O[C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C44H44N2O9S/c1-33-22-24-38(25-23-33)56(48,49)46(27-26-45)44(47)55-43-42(53-31-37-20-12-5-13-21-37)41(52-30-36-18-10-4-11-19-36)40(51-29-35-16-8-3-9-17-35)39(54-43)32-50-28-34-14-6-2-7-15-34/h2-25,39-43H,27-32H2,1H3/t39-,40+,41+,42-,43+/m1/s1 |
| InChIKey | RRLQOBPWCXYYKW-RPYCNASESA-N |
| XLogP | 7.34 |
| TPSA | 133.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.91 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|