C41H41ClO5 — CID 150893456
(2R,3R,4R,5R,6R)-2-(3-chloro-5-methylphenyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 150893456) has the molecular formula C41H41ClO5 and a molecular weight of 649.23 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(3-chloro-5-methylphenyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4R,5R,6R)-2-(3-chloro-5-methylphenyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 150893456 |
| Molecular Formula | C41H41ClO5 |
| Molecular Weight | 649.23 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(3-chloro-5-methylphenyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | Cc1cc(Cl)cc([C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)c1 |
| InChI | InChI=1S/C41H41ClO5/c1-30-22-35(24-36(42)23-30)38-40(45-27-33-18-10-4-11-19-33)41(46-28-34-20-12-5-13-21-34)39(44-26-32-16-8-3-9-17-32)37(47-38)29-43-25-31-14-6-2-7-15-31/h2-24,37-41H,25-29H2,1H3/t37-,38-,39-,40?,41+/m1/s1 |
| InChIKey | KYMPNAGVLSRQEE-YEWBTZCESA-N |
| XLogP | 9.06 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.23 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |