C43H44O7 — CID 58786127
3-(methoxymethyl)-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzaldehyde (PubChem CID 58786127) has the molecular formula C43H44O7 and a molecular weight of 672.82 g/mol. Its IUPAC name is 3-(methoxymethyl)-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzaldehyde.
| Compound Name | 3-(methoxymethyl)-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 58786127 |
| Molecular Formula | C43H44O7 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | 3-(methoxymethyl)-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzaldehyde |
| SMILES | COCc1cc(C=O)cc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)c1 |
| InChI | InChI=1S/C43H44O7/c1-45-26-37-22-36(25-44)23-38(24-37)40-42(48-29-34-18-10-4-11-19-34)43(49-30-35-20-12-5-13-21-35)41(47-28-33-16-8-3-9-17-33)39(50-40)31-46-27-32-14-6-2-7-15-32/h2-25,39-43H,26-31H2,1H3/t39-,40+,41-,42?,43+/m1/s1 |
| InChIKey | GUVXEHICDPGMDO-MPLAWEPJSA-N |
| XLogP | 8.06 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|