C36H38O6 — CID 91195205
2-[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde (PubChem CID 91195205) has the molecular formula C36H38O6 and a molecular weight of 566.69 g/mol. Its IUPAC name is 2-[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 91195205 |
| Molecular Formula | C36H38O6 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 2-[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
| SMILES | O=CC[C@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C36H38O6/c37-22-21-32-34(39-24-29-15-7-2-8-16-29)36(41-26-31-19-11-4-12-20-31)35(40-25-30-17-9-3-10-18-30)33(42-32)27-38-23-28-13-5-1-6-14-28/h1-20,22,32-36H,21,23-27H2/t32-,33?,34?,35+,36+/m1/s1 |
| InChIKey | WTNFDXKLFWOMIR-JBGMDRLWSA-N |
| XLogP | 6.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|