C40H41NO5 — CID 10394032
(2Z,4Z)-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexa-2,4-dienenitrile (PubChem CID 10394032) has the molecular formula C40H41NO5 and a molecular weight of 615.77 g/mol. Its IUPAC name is (2Z,4Z)-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexa-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 10394032 |
| Molecular Formula | C40H41NO5 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | (2Z,4Z)-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexa-2,4-dienenitrile |
| SMILES | N#C/C=C\C=C/C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H41NO5/c41-26-16-2-1-15-25-36-38(43-28-33-19-9-4-10-20-33)40(45-30-35-23-13-6-14-24-35)39(44-29-34-21-11-5-12-22-34)37(46-36)31-42-27-32-17-7-3-8-18-32/h1-24,36-40H,25,27-31H2/b15-1-,16-2-/t36-,37-,38+,39-,40-/m1/s1 |
| InChIKey | LTWFVHBHRZJLKC-KSMPPLBHSA-N |
| XLogP | 7.75 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|